CAS 1215681-42-7 appears in our catalog under these names: Imipramine N-Oxide Hydrate, >95% (HPLC), Imipramine N-oxide hydrate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 25mg.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine oxide;hydrate (CAS 1215681-42-7) is a chemical compound with the molecular formula C19H26N2O2 and a molecular weight of 314.4 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine oxide;hydrate. InChIKey: RQXNUQYIRZIYMU-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine oxide;hydrate |
| InChIKey | RQXNUQYIRZIYMU-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCN1C2=CC=CC=C2CCC3=CC=CC=C31)[O-].O |
Computed by PubChem (NCBI)