CAS 2125941-92-4 is the registry number for Palonosetron Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(8S)-8-[[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (CAS 2125941-92-4) is a chemical compound with the molecular formula C19H26N2O2 and a molecular weight of 314.4 g/mol. IUPAC name: (8S)-8-[[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid. InChIKey: GIIYMZHZCASHNL-NVXWUHKLSA-N.
| Molecular formula | C19H26N2O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (8S)-8-[[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| InChIKey | GIIYMZHZCASHNL-NVXWUHKLSA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=CC=C2C(=O)O)CN[C@@H]3CN4CCC3CC4 |
Computed by PubChem (NCBI)