CAS 148369-91-9 appears in our catalog under these names: (S)-Daipen, 95%, (S)–1,1–Bis(4–methoxyphenyl)–3–methylbutane–1,2–diamine, (S)-1,1-Bis(4-methoxyphenyl)-3-methylbutane-1,2-diamine, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(2S)-1,1-bis(4-methoxyphenyl)-3-methylbutane-1,2-diamine (CAS 148369-91-9) is a chemical compound with the molecular formula C19H26N2O2 and a molecular weight of 314.4 g/mol. IUPAC name: (2S)-1,1-bis(4-methoxyphenyl)-3-methylbutane-1,2-diamine. InChIKey: WDYGPMAMBXJESZ-SFHVURJKSA-N.
| Molecular formula | C19H26N2O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (2S)-1,1-bis(4-methoxyphenyl)-3-methylbutane-1,2-diamine |
| InChIKey | WDYGPMAMBXJESZ-SFHVURJKSA-N |
| SMILES | CC(C)[C@@H](C(C1=CC=C(C=C1)OC)(C2=CC=C(C=C2)OC)N)N |
Computed by PubChem (NCBI)