CAS 1216808-01-3 is the registry number for Imipramine-d6 N-Oxide Hydrate. Offered by: TRC. Available pack sizes: 25mg.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-bis(trideuteriomethyl)propan-1-amine oxide;hydrate (CAS 1216808-01-3) is a chemical compound with the molecular formula C19H26N2O2 and a molecular weight of 320.5 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-bis(trideuteriomethyl)propan-1-amine oxide;hydrate. InChIKey: RQXNUQYIRZIYMU-TXHXQZCNSA-N.
| Molecular formula | C19H26N2O2 |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-bis(trideuteriomethyl)propan-1-amine oxide;hydrate |
| InChIKey | RQXNUQYIRZIYMU-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])[N+](CCCN1C2=CC=CC=C2CCC3=CC=CC=C31)(C([2H])([2H])[2H])[O-].O |
Computed by PubChem (NCBI)