CAS 1215711-91-3 appears in our catalog under these names: N-gamma-Acetyl-5-methoxykynurenamine Hydrochloride, >95% (HPLC), AMK (hydrochloride), AMK (hydrochloride), N1-Acetyl-5-methoxykynuramine (hydrochloride), N1-Acetyl-5-methoxykynuramine hydrochloride, 98%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 5 mg, 10 mg.
N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]acetamide;hydrochloride (CAS 1215711-91-3) is a chemical compound with the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. IUPAC name: N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]acetamide;hydrochloride. InChIKey: JMBYMENFYWCJRD-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O3 |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]acetamide;hydrochloride |
| InChIKey | JMBYMENFYWCJRD-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCC(=O)C1=C(C=CC(=C1)OC)N.Cl |
Computed by PubChem (NCBI)