Products 1215849-96-9
CAS 1215849-96-9 appears in our catalog under these names: FSC231, FSC-231, 99.66% ,, 99.66% ,, PICK1 PDZ Domain Inhibitor, 1PC X 10MG, FSC231, 99.84%, FSC231, 98%. Offered by: GLPBio, Chemat, Sigma-Aldrich, MedChemExpress, Ambeed. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 200mg, 25 mg.
Ethyl N-[(E)-2-cyano-3-(3,4-dichlorophenyl)prop-2-enoyl]carbamate (CAS 1215849-96-9) is a chemical compound with the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.13 g/mol. IUPAC name: ethyl N-[(E)-2-cyano-3-(3,4-dichlorophenyl)prop-2-enoyl]carbamate. InChIKey: MDFDJDSQTKNBQU-WEVVVXLNSA-N.
| Molecular formula | C13H10Cl2N2O3 |
|---|---|
| Molecular weight | 313.13 g/mol |
| IUPAC name | ethyl N-[(E)-2-cyano-3-(3,4-dichlorophenyl)prop-2-enoyl]carbamate |
| InChIKey | MDFDJDSQTKNBQU-WEVVVXLNSA-N |
| SMILES | CCOC(=O)NC(=O)/C(=C/C1=CC(=C(C=C1)Cl)Cl)/C#N |
Computed by PubChem (NCBI)