CAS 1246060-75-2 is the registry number for N-(2,4-Dichlorophenyl)-1,4-dihydro-5-methoxy-4-oxo-2-Pyridinecarboxamide. Offered by: TRC. Available pack sizes: 100mg.
N-(2,4-dichlorophenyl)-5-methoxy-4-oxo-1H-pyridine-2-carboxamide (CAS 1246060-75-2) is a chemical compound with the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.13 g/mol. IUPAC name: N-(2,4-dichlorophenyl)-5-methoxy-4-oxo-1H-pyridine-2-carboxamide. InChIKey: ZXLQOVKVCNORPB-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O3 |
|---|---|
| Molecular weight | 313.13 g/mol |
| IUPAC name | N-(2,4-dichlorophenyl)-5-methoxy-4-oxo-1H-pyridine-2-carboxamide |
| InChIKey | ZXLQOVKVCNORPB-UHFFFAOYSA-N |
| SMILES | COC1=CNC(=CC1=O)C(=O)NC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)