CAS 886496-70-4 appears in our catalog under these names: 4-(3,4-Dichlorobenzamido)-1-methyl-1H-pyrrole-2-carboxylic acid, 97%, 4-(3,4-Dichloro-benzoylamino)-1-methyl-1H-pyrrole--2-carboxylic acid, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g.
4-[(3,4-dichlorobenzoyl)amino]-1-methylpyrrole-2-carboxylic acid (CAS 886496-70-4) is a chemical compound with the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.13 g/mol. IUPAC name: 4-[(3,4-dichlorobenzoyl)amino]-1-methylpyrrole-2-carboxylic acid. InChIKey: UJHUMEYJIHQQRE-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O3 |
|---|---|
| Molecular weight | 313.13 g/mol |
| IUPAC name | 4-[(3,4-dichlorobenzoyl)amino]-1-methylpyrrole-2-carboxylic acid |
| InChIKey | UJHUMEYJIHQQRE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)O)NC(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)