Products 89593-76-0
CAS 89593-76-0 is the registry number for Ethyl 4-(4,5-dichloro-6-oxopyridazin-1(6H)-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate (CAS 89593-76-0) is a chemical compound with the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.13 g/mol. IUPAC name: ethyl 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate. InChIKey: BHJNVIXRXGBUMD-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O3 |
|---|---|
| Molecular weight | 313.13 g/mol |
| IUPAC name | ethyl 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
| InChIKey | BHJNVIXRXGBUMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N2C(=O)C(=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)