Products 121587-20-0
CAS 121587-20-0 appears in our catalog under these names: 6–Demethoxycleomiscosin A, 6-Demethoxycleomiscosin A, Demethoxyisodaphneticin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 10 mg, 5 mg, 1 mg.
(2R,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-9-one (CAS 121587-20-0) is a chemical compound with the molecular formula C19H16O7 and a molecular weight of 356.3 g/mol. IUPAC name: (2R,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-9-one. InChIKey: SPQBUENVXULSQS-NVXWUHKLSA-N.
| Molecular formula | C19H16O7 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | (2R,3R)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-9-one |
| InChIKey | SPQBUENVXULSQS-NVXWUHKLSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H](OC3=C(O2)C=CC4=C3OC(=O)C=C4)CO)O |
Computed by PubChem (NCBI)