Products 87414-44-6
CAS 87414-44-6 appears in our catalog under these names: Butyrolactone II, Butyrolactone II. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 500ug, Get quote.
Methyl (2R)-4-hydroxy-3-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-5-oxofuran-2-carboxylate (CAS 87414-44-6) is a chemical compound with the molecular formula C19H16O7 and a molecular weight of 356.3 g/mol. IUPAC name: methyl (2R)-4-hydroxy-3-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-5-oxofuran-2-carboxylate. InChIKey: AEKPZNDJHWFONI-LJQANCHMSA-N.
| Molecular formula | C19H16O7 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | methyl (2R)-4-hydroxy-3-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-5-oxofuran-2-carboxylate |
| InChIKey | AEKPZNDJHWFONI-LJQANCHMSA-N |
| SMILES | COC(=O)[C@]1(C(=C(C(=O)O1)O)C2=CC=C(C=C2)O)CC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)