CAS 70610-26-3 is the registry number for 7,9-Dimethoxy-6-(4-methoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromen-8-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,9-dimethoxy-6-(4-methoxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one (CAS 70610-26-3) is a chemical compound with the molecular formula C19H16O7 and a molecular weight of 356.3 g/mol. IUPAC name: 7,9-dimethoxy-6-(4-methoxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one. InChIKey: LWUQVHKGVXRUPD-UHFFFAOYSA-N.
| Molecular formula | C19H16O7 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 7,9-dimethoxy-6-(4-methoxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one |
| InChIKey | LWUQVHKGVXRUPD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C4=C(C=C3O2)OCO4)OC)OC |
Computed by PubChem (NCBI)