CAS 887871-24-1 appears in our catalog under these names: ([3-(3,4-Dimethoxyphenyl)-2-oxo-2h-chromen-7-yl]oxy)acetic acid, 95%, ((3-(3,4-DImethoxyphenyl)-2-oxo-2h-chromen-7-yl)oxy)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl]oxyacetic acid (CAS 887871-24-1) is a chemical compound with the molecular formula C19H16O7 and a molecular weight of 356.3 g/mol. IUPAC name: 2-[3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl]oxyacetic acid. InChIKey: CUBJYGSQJQQUNX-UHFFFAOYSA-N.
| Molecular formula | C19H16O7 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 2-[3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl]oxyacetic acid |
| InChIKey | CUBJYGSQJQQUNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC3=C(C=C(C=C3)OCC(=O)O)OC2=O)OC |
Computed by PubChem (NCBI)