CAS 1215963-60-2 is the registry number for 2-(Pyridin-3-yl)imidazo(1,2-a)pyridin-3-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-pyridin-3-ylimidazo[1,2-a]pyridin-3-amine (CAS 1215963-60-2) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-pyridin-3-ylimidazo[1,2-a]pyridin-3-amine. InChIKey: YNBXOLRBDZPWDW-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-pyridin-3-ylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | YNBXOLRBDZPWDW-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)N)C3=CN=CC=C3 |
Computed by PubChem (NCBI)