CAS 1216157-59-3 is the registry number for 6-(2,4-Dimethylphenoxy)nicotinaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2,4-dimethylphenoxy)pyridine-3-carbaldehyde (CAS 1216157-59-3) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 6-(2,4-dimethylphenoxy)pyridine-3-carbaldehyde. InChIKey: SRMOCMRZDNESTR-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 6-(2,4-dimethylphenoxy)pyridine-3-carbaldehyde |
| InChIKey | SRMOCMRZDNESTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=NC=C(C=C2)C=O)C |
Computed by PubChem (NCBI)