Products 121616-32-8

CAS 121616-32-8 is the registry number for Methyl 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate (CAS 121616-32-8) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate. InChIKey: LNRZMDAFEJIQDM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17NO4
Molecular weight311.3 g/mol
IUPAC namemethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate
InChIKeyLNRZMDAFEJIQDM-UHFFFAOYSA-N
SMILESCOC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)