CAS 1216231-53-6 appears in our catalog under these names: 6-Bromo-2,8-dimethylimidazo(1,2-a)pyridine, 6-Bromo-2,8-dimethylimidazo[1,2-a]pyridine, 95%, 6-Bromo-2,8-dimethylimidazo[1,2-a]pyridine, 97%, 97%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
6-bromo-2,8-dimethylimidazo[1,2-a]pyridine (CAS 1216231-53-6) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-2,8-dimethylimidazo[1,2-a]pyridine. InChIKey: XXIFFUAPZHTUJK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-2,8-dimethylimidazo[1,2-a]pyridine |
| InChIKey | XXIFFUAPZHTUJK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2)C)Br |
Computed by PubChem (NCBI)