CAS 1216305-24-6 is the registry number for 6-Bromo-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid (CAS 1216305-24-6) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 6-bromo-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid. InChIKey: CMRIOCRUCWEZTI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 6-bromo-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid |
| InChIKey | CMRIOCRUCWEZTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2C(=O)O)C)Br |
Computed by PubChem (NCBI)