CAS 1216325-61-9 is the registry number for (1E)-1-(4-(2,2-Difluoroethoxy)-3-methoxyphenyl)ethanone oxime. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(NE)-N-[1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethylidene]hydroxylamine (CAS 1216325-61-9) is a chemical compound with the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. IUPAC name: (NE)-N-[1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethylidene]hydroxylamine. InChIKey: REMMIJNNJKKAFI-VGOFMYFVSA-N.
| Molecular formula | C11H13F2NO3 |
|---|---|
| Molecular weight | 245.22 g/mol |
| IUPAC name | (NE)-N-[1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethylidene]hydroxylamine |
| InChIKey | REMMIJNNJKKAFI-VGOFMYFVSA-N |
| SMILES | C/C(=N\O)/C1=CC(=C(C=C1)OCC(F)F)OC |
Computed by PubChem (NCBI)