CAS 2353937-87-6 is the registry number for tert-Butyl (2,5-difluoro-4-hydroxyphenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(2,5-difluoro-4-hydroxyphenyl)carbamate (CAS 2353937-87-6) is a chemical compound with the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. IUPAC name: tert-butyl N-(2,5-difluoro-4-hydroxyphenyl)carbamate. InChIKey: HOHHGGLOAULQLD-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO3 |
|---|---|
| Molecular weight | 245.22 g/mol |
| IUPAC name | tert-butyl N-(2,5-difluoro-4-hydroxyphenyl)carbamate |
| InChIKey | HOHHGGLOAULQLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1F)O)F |
Computed by PubChem (NCBI)