Products 1286792-84-4
CAS 1286792-84-4 appears in our catalog under these names: Ethyl (5-acetyl-1-methylpyrrole-2-yl)difluoroacetate, 95-<97%, Ethyl 2-(5-acetyl-1-methyl-1H-pyrrol-2-yl)-2,2-difluoroacetate. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
Ethyl 2-(5-acetyl-1-methylpyrrol-2-yl)-2,2-difluoroacetate (CAS 1286792-84-4) is a chemical compound with the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. IUPAC name: ethyl 2-(5-acetyl-1-methylpyrrol-2-yl)-2,2-difluoroacetate. InChIKey: WTOZNLNQXBKBPH-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO3 |
|---|---|
| Molecular weight | 245.22 g/mol |
| IUPAC name | ethyl 2-(5-acetyl-1-methylpyrrol-2-yl)-2,2-difluoroacetate |
| InChIKey | WTOZNLNQXBKBPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(N1C)C(=O)C)(F)F |
Computed by PubChem (NCBI)