CAS 2755722-70-2 is the registry number for 3-(3,4-Difluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-(3,4-difluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide (CAS 2755722-70-2) is a chemical compound with the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. IUPAC name: 3-(3,4-difluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide. InChIKey: DOLXXACODOJJCS-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO3 |
|---|---|
| Molecular weight | 245.22 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)-3-hydroxy-N-methoxy-N-methylpropanamide |
| InChIKey | DOLXXACODOJJCS-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CC(C1=CC(=C(C=C1)F)F)O)OC |
Computed by PubChem (NCBI)