Products 121633-50-9
CAS 121633-50-9 appears in our catalog under these names: Citric Acid-2,4-13C2, Citric acid-2,4-13C2, >95% (HPLC), Citric acid–2,4–13C2, CITRIC-2,4-13C2 ACID, 99 ATOM % 13C, Citric acid-2,4-¹³C₂, ≥99 atom% 13C,≥99%, ≥99 atom% 13C,≥99%. Offered by: Chemat Brand, TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 25mg, 50mg, 10mg, 5mg, 5 mg, 1 mg.
2-hydroxy(1,3-13C2)propane-1,2,3-tricarboxylic acid (CAS 121633-50-9) is a chemical compound with the molecular formula C6H8O7 and a molecular weight of 194.11 g/mol. IUPAC name: 2-hydroxy(1,3-13C2)propane-1,2,3-tricarboxylic acid. InChIKey: KRKNYBCHXYNGOX-ZDOIIHCHSA-N.
| Molecular formula | C6H8O7 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 2-hydroxy(1,3-13C2)propane-1,2,3-tricarboxylic acid |
| InChIKey | KRKNYBCHXYNGOX-ZDOIIHCHSA-N |
| SMILES | [13CH2](C(=O)O)C([13CH2]C(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Citric acid-2,4-13C2, 2-hydroxy(1,3-13C2)propane-1,2,3-tricarboxylic acid, Citric acid-2,4-13C?, 2-Hydroxy-1,2,3-propane-1,3-13C2-tricarboxylic Acid, Citric Acid-24-13C2, orb2939814, Citric acid-2,4-(1)(3)C, Citric acid-2,4-13C2, 99 atom % 13C, 2-hydroxypropane-1,2,3-tricarboxylic-1,3-13C2 acid, 2-Hydroxy(1,3-~13~C_2_)propane-1,2,3-tricarboxylic acid