Products 302912-06-7
CAS 302912-06-7 appears in our catalog under these names: Citric acid-13C3, 98%, Citric-1,5-13C2 acid, 98 atom % 13C. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: 10 mg, 5 mg, 100MG.
2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 302912-06-7) is a chemical compound with the molecular formula C6H8O7 and a molecular weight of 194.11 g/mol. IUPAC name: 2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: KRKNYBCHXYNGOX-CQDYUVAPSA-N.
| Molecular formula | C6H8O7 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | KRKNYBCHXYNGOX-CQDYUVAPSA-N |
| SMILES | C([13C](=O)O)C(C[13C](=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)