Products 287389-42-8
CAS 287389-42-8 appears in our catalog under these names: Citric Acid-13C6, >95% (HPLC), Citric acid–13C6, CITRIC ACID-13C6, 99 ATOM % 13C, 97% CP, Citric acid-¹³C₆, ≥99 atom% 13C,≥97%, ≥99 atom% 13C,≥97%, Citric acid-13C6, 99.90%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 100MG, 10 mg, 1 mg, 5 mg.
2-hydroxy(1,2,3-13C3)propane-1,2,3-tricarboxylic acid (CAS 287389-42-8) is a chemical compound with the molecular formula C6H8O7 and a molecular weight of 198.08 g/mol. IUPAC name: 2-hydroxy(1,2,3-13C3)propane-1,2,3-tricarboxylic acid. InChIKey: KRKNYBCHXYNGOX-IDEBNGHGSA-N.
| Molecular formula | C6H8O7 |
|---|---|
| Molecular weight | 198.08 g/mol |
| IUPAC name | 2-hydroxy(1,2,3-13C3)propane-1,2,3-tricarboxylic acid |
| InChIKey | KRKNYBCHXYNGOX-IDEBNGHGSA-N |
| SMILES | [13CH2]([13C](=O)O)[13C]([13CH2][13C](=O)O)([13C](=O)O)O |
Computed by PubChem (NCBI)