CAS 80876-59-1 appears in our catalog under these names: (R)-2-((2S,3R,4R)-3,4-Dihydroxy-5-oxotetrahydrofuran-2-yl)-2-hydroxyacetic acid, 95%, L-Idaric-1,4-lactone, L-Idaric acid 1,4-lactone, L-Idaric acid,1,4-lactone. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 0,25mg, 0,1mg, 0,5mg, 2mg, Get quote.
(2R)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid (CAS 80876-59-1) is a chemical compound with the molecular formula C6H8O7 and a molecular weight of 192.12 g/mol. IUPAC name: (2R)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid. InChIKey: XECPAIJNBXCOBO-AJSXGEPRSA-N.
| Molecular formula | C6H8O7 |
|---|---|
| Molecular weight | 192.12 g/mol |
| IUPAC name | (2R)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid |
| InChIKey | XECPAIJNBXCOBO-AJSXGEPRSA-N |
| SMILES | [C@H]1([C@H](C(=O)O[C@@H]1[C@H](C(=O)O)O)O)O |
Computed by PubChem (NCBI)