CAS 1216524-74-1 is the registry number for Indoprofen-d3. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg.
3,3,3-trideuterio-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]propanoic acid (CAS 1216524-74-1) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 284.32 g/mol. IUPAC name: 3,3,3-trideuterio-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]propanoic acid. InChIKey: RJMIEHBSYVWVIN-FIBGUPNXSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 284.32 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]propanoic acid |
| InChIKey | RJMIEHBSYVWVIN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)O |
Computed by PubChem (NCBI)