Products 1216524-74-1

CAS 1216524-74-1 is the registry number for Indoprofen-d3. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

3,3,3-trideuterio-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]propanoic acid (CAS 1216524-74-1) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 284.32 g/mol. IUPAC name: 3,3,3-trideuterio-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]propanoic acid. InChIKey: RJMIEHBSYVWVIN-FIBGUPNXSA-N.

Identity
Molecular formulaC17H15NO3
Molecular weight284.32 g/mol
IUPAC name3,3,3-trideuterio-2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]propanoic acid
InChIKeyRJMIEHBSYVWVIN-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)O

Computed by PubChem (NCBI)

Synonyms: Indoprofen-d3