Products 1216637-77-2

CAS 1216637-77-2 is the registry number for 5-Bromo-6-morpholin-4-ylnicotinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g.

Structural formula: {0} (CAS {1})

5-bromo-6-morpholin-4-ylpyridine-3-carboxylic acid (CAS 1216637-77-2) is a chemical compound with the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. IUPAC name: 5-bromo-6-morpholin-4-ylpyridine-3-carboxylic acid. InChIKey: CDPWXVYHWVBXED-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrN2O3
Molecular weight287.11 g/mol
IUPAC name5-bromo-6-morpholin-4-ylpyridine-3-carboxylic acid
InChIKeyCDPWXVYHWVBXED-UHFFFAOYSA-N
SMILESC1COCCN1C2=C(C=C(C=N2)C(=O)O)Br

Computed by PubChem (NCBI)