CAS 1849592-41-1 is the registry number for 6-Bromo-8-methoxy-3,3-dimethyl-2,3-dihydroimidazo[1,5-a]pyridine-1,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-methoxy-3,3-dimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione (CAS 1849592-41-1) is a chemical compound with the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. IUPAC name: 6-bromo-8-methoxy-3,3-dimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione. InChIKey: IQUVETQCUIVSBE-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O3 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | 6-bromo-8-methoxy-3,3-dimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione |
| InChIKey | IQUVETQCUIVSBE-UHFFFAOYSA-N |
| SMILES | CC1(NC(=O)C2=C(C=C(C(=O)N21)Br)OC)C |
Computed by PubChem (NCBI)