Products 1249222-58-9

CAS 1249222-58-9 is the registry number for 2-(5-Bromonicotinamido)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(5-bromopyridine-3-carbonyl)amino]-2-methylpropanoic acid (CAS 1249222-58-9) is a chemical compound with the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. IUPAC name: 2-[(5-bromopyridine-3-carbonyl)amino]-2-methylpropanoic acid. InChIKey: DDDPSBVMKQNRTB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrN2O3
Molecular weight287.11 g/mol
IUPAC name2-[(5-bromopyridine-3-carbonyl)amino]-2-methylpropanoic acid
InChIKeyDDDPSBVMKQNRTB-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)NC(=O)C1=CC(=CN=C1)Br

Computed by PubChem (NCBI)