CAS 477846-96-1 appears in our catalog under these names: 4-(2-Bromo-4-nitrophenyl)morpholine, 98%, 4–(2–Bromo–4–nitrophenyl)morpholine, 4-(2-Bromo-4-nitrophenyl)morpholine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 100g, 5g, 100mg, 250mg.
4-(2-bromo-4-nitrophenyl)morpholine (CAS 477846-96-1) is a chemical compound with the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. IUPAC name: 4-(2-bromo-4-nitrophenyl)morpholine. InChIKey: FDGXBSITNUOBQT-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O3 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | 4-(2-bromo-4-nitrophenyl)morpholine |
| InChIKey | FDGXBSITNUOBQT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)