Products 1216758-11-0

CAS 1216758-11-0 is the registry number for 2-Aminocyclohex-3-ene-1-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride (CAS 1216758-11-0) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: 2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride. InChIKey: UQGIRSZIKGUXTO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClNO2
Molecular weight177.63 g/mol
IUPAC name2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride
InChIKeyUQGIRSZIKGUXTO-UHFFFAOYSA-N
SMILESC1CC(C(C=C1)N)C(=O)O.Cl

Computed by PubChem (NCBI)