Products 131783-54-5

CAS 131783-54-5 is the registry number for (1R,2S)-(+)-2-Aminocyclohex-3-enecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(1R,2S)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride (CAS 131783-54-5) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1R,2S)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride. InChIKey: UQGIRSZIKGUXTO-IBTYICNHSA-N.

Identity
Molecular formulaC7H12ClNO2
Molecular weight177.63 g/mol
IUPAC name(1R,2S)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride
InChIKeyUQGIRSZIKGUXTO-IBTYICNHSA-N
SMILESC1C[C@H]([C@H](C=C1)N)C(=O)O.Cl

Computed by PubChem (NCBI)