Products 2749433-00-7
CAS 2749433-00-7 appears in our catalog under these names: N–methyl Benzedrone (hydrochloride), N-Methyl benzedrone (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
2-[benzyl(methyl)amino]-1-(4-methylphenyl)propan-1-one;hydrochloride (CAS 2749433-00-7) is a chemical compound with the molecular formula C18H22ClNO and a molecular weight of 303.8 g/mol. IUPAC name: 2-[benzyl(methyl)amino]-1-(4-methylphenyl)propan-1-one;hydrochloride. InChIKey: ZXADUOBQOKQUSV-UHFFFAOYSA-N.
| Molecular formula | C18H22ClNO |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 2-[benzyl(methyl)amino]-1-(4-methylphenyl)propan-1-one;hydrochloride |
| InChIKey | ZXADUOBQOKQUSV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)N(C)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)