Products 213274-16-9
CAS 213274-16-9 appears in our catalog under these names: (2S)-2-(Methoxydiphenylmethyl)pyrrolidine hydrochloride, (S)-2-(Methoxydiphenylmethyl)pyrrolidine hydrochloride, 99%, 99%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 25mg, 100mg, 500mg.
(2S)-2-[methoxy(diphenyl)methyl]pyrrolidine;hydrochloride (CAS 213274-16-9) is a chemical compound with the molecular formula C18H22ClNO and a molecular weight of 303.8 g/mol. IUPAC name: (2S)-2-[methoxy(diphenyl)methyl]pyrrolidine;hydrochloride. InChIKey: FPHZYFSWELMXRE-LMOVPXPDSA-N.
| Molecular formula | C18H22ClNO |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | (2S)-2-[methoxy(diphenyl)methyl]pyrrolidine;hydrochloride |
| InChIKey | FPHZYFSWELMXRE-LMOVPXPDSA-N |
| SMILES | COC([C@@H]1CCCN1)(C2=CC=CC=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)