Products 1217115-53-1
CAS 1217115-53-1 is the registry number for Suberanilic Acid-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
8-oxo-8-(2,3,4,5,6-pentadeuterioanilino)octanoic acid (CAS 1217115-53-1) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 254.34 g/mol. IUPAC name: 8-oxo-8-(2,3,4,5,6-pentadeuterioanilino)octanoic acid. InChIKey: PAXDAFSGJPGLGR-YQYLVRRTSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 254.34 g/mol |
| IUPAC name | 8-oxo-8-(2,3,4,5,6-pentadeuterioanilino)octanoic acid |
| InChIKey | PAXDAFSGJPGLGR-YQYLVRRTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)CCCCCCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)