CAS 1217295-84-5 is the registry number for Lithium 2-(pyridazin-4-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 2-pyridazin-4-ylacetate (CAS 1217295-84-5) is a chemical compound with the molecular formula C6H5LiN2O2 and a molecular weight of 144.1 g/mol. IUPAC name: lithium 2-pyridazin-4-ylacetate. InChIKey: GMLFTJDKUVXPMO-UHFFFAOYSA-M.
| Molecular formula | C6H5LiN2O2 |
|---|---|
| Molecular weight | 144.1 g/mol |
| IUPAC name | lithium 2-pyridazin-4-ylacetate |
| InChIKey | GMLFTJDKUVXPMO-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CN=NC=C1CC(=O)[O-] |
Computed by PubChem (NCBI)