CAS 1803601-33-3 appears in our catalog under these names: lithium(1+) ion 2-(pyrazin-2-yl)acetate, 95%, Lithium 2-(pyrazin-2-yl)acetate, 98%, Lithium salt 2–pyrazin–2–ylacetic acid, Lithium(1+) ion 2-(pyrazin-2-yl)acetate. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 2,5g.
Lithium 2-pyrazin-2-ylacetate (CAS 1803601-33-3) is a chemical compound with the molecular formula C6H5LiN2O2 and a molecular weight of 144.1 g/mol. IUPAC name: lithium 2-pyrazin-2-ylacetate. InChIKey: WDCDXICBVYOSMA-UHFFFAOYSA-M.
| Molecular formula | C6H5LiN2O2 |
|---|---|
| Molecular weight | 144.1 g/mol |
| IUPAC name | lithium 2-pyrazin-2-ylacetate |
| InChIKey | WDCDXICBVYOSMA-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CN=C(C=N1)CC(=O)[O-] |
Computed by PubChem (NCBI)