CAS 1845687-62-8 appears in our catalog under these names: 2-(Pyridazin-3-yl)acetic acid lithium salt, 95%, Lithium 2-(pyridazin-3-yl)acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Lithium 2-pyridazin-3-ylacetate (CAS 1845687-62-8) is a chemical compound with the molecular formula C6H5LiN2O2 and a molecular weight of 144.1 g/mol. IUPAC name: lithium 2-pyridazin-3-ylacetate. InChIKey: QEQFGNRJYXXBDB-UHFFFAOYSA-M.
| Molecular formula | C6H5LiN2O2 |
|---|---|
| Molecular weight | 144.1 g/mol |
| IUPAC name | lithium 2-pyridazin-3-ylacetate |
| InChIKey | QEQFGNRJYXXBDB-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC(=NN=C1)CC(=O)[O-] |
Computed by PubChem (NCBI)