CAS 1956356-31-2 appears in our catalog under these names: Lithium 2–(pyrimidin–4–yl)acetate, Lithium 2-(pyrimidin-4-yl)acetate. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
Lithium 2-pyrimidin-4-ylacetate (CAS 1956356-31-2) is a chemical compound with the molecular formula C6H5LiN2O2 and a molecular weight of 144.1 g/mol. IUPAC name: lithium 2-pyrimidin-4-ylacetate. InChIKey: ZHKKMDDRZDKPID-UHFFFAOYSA-M.
| Molecular formula | C6H5LiN2O2 |
|---|---|
| Molecular weight | 144.1 g/mol |
| IUPAC name | lithium 2-pyrimidin-4-ylacetate |
| InChIKey | ZHKKMDDRZDKPID-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CN=CN=C1CC(=O)[O-] |
Computed by PubChem (NCBI)