CAS 1217448-78-6 is the registry number for Fmoc-Ser(tBu)-OH-13C3,15N, 99.5%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 1 mg, 25 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy](1,2,3-13C3)propanoic acid (CAS 1217448-78-6) is a chemical compound with the molecular formula C22H25NO5 and a molecular weight of 387.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy](1,2,3-13C3)propanoic acid. InChIKey: REITVGIIZHFVGU-FIEXIFIBSA-N.
| Molecular formula | C22H25NO5 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy](1,2,3-13C3)propanoic acid |
| InChIKey | REITVGIIZHFVGU-FIEXIFIBSA-N |
| SMILES | CC(C)(C)O[13CH2][13C@@H]([13C](=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)