CAS 387867-79-0 is the registry number for Fmoc-Ser(tBu)-OH-15N, 99.8%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg.
2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 387867-79-0) is a chemical compound with the molecular formula C22H25NO5 and a molecular weight of 384.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: REITVGIIZHFVGU-VSBQSISVSA-N.
| Molecular formula | C22H25NO5 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | REITVGIIZHFVGU-VSBQSISVSA-N |
| SMILES | CC(C)(C)OCC(C(=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)