CAS 1217452-48-6 appears in our catalog under these names: Fmoc–Pro–OH–13C5,15N, FMOC-PRO-OH-13C5,15N, 98 ATOM% 13C, 98&, Fmoc-Pro-OH-13C5,15N, 99.90%. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 50mg, 1G, 50 mg, 100 mg, 25 mg, 10 mg, 5 mg.
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)(2,3,4,5-13C4,115N)azolidine-2-carboxylic acid (CAS 1217452-48-6) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 343.33 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)(2,3,4,5-13C4,115N)azolidine-2-carboxylic acid. InChIKey: ZPGDWQNBZYOZTI-COMNNLFWSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 343.33 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)(2,3,4,5-13C4,115N)azolidine-2-carboxylic acid |
| InChIKey | ZPGDWQNBZYOZTI-COMNNLFWSA-N |
| SMILES | [13CH2]1[13CH2][13C@H]([15N]([13CH2]1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)[13C](=O)O |
Computed by PubChem (NCBI)