CAS 885951-89-3 appears in our catalog under these names: Fmoc-1-pyrrolidine-3-carboxylic acid, 97%, Fmoc-1-pyrrolidine-3-carboxylic acid, >95% (HPLC), 1-N-FMOC-PYRROLIDINE-3-CARBOXYLIC ACID, 95%, 1-(((9H-Fluoren-9-yl)methoxy)carbonyl)pyrrolidine-3-carboxylic acid, 95%, Fmoc-DL-β-Pro-OH, 95%, 95%. Offered by: Combi-blocks, TRC, Fluorochem, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 25g, 10g.
1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 885951-89-3) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)