Products 1820575-03-8

CAS 1820575-03-8 is the registry number for 1-(9H-fluoren-9-ylmethyl) 2-methyl (2S)-azetidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S)-azetidine-1,2-dicarboxylate (CAS 1820575-03-8) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S)-azetidine-1,2-dicarboxylate. InChIKey: UINFLIJDOKXCEL-SFHVURJKSA-N.

Identity
Molecular formulaC20H19NO4
Molecular weight337.4 g/mol
IUPAC name1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2S)-azetidine-1,2-dicarboxylate
InChIKeyUINFLIJDOKXCEL-SFHVURJKSA-N
SMILESCOC(=O)[C@@H]1CCN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)