Products 1217464-18-0
CAS 1217464-18-0 appears in our catalog under these names: L–Alanine–13C,d, L-ASPARAGINE-13C4,15N2,D8, 98 ATOM% 13C&, L-Asparagine-13C4,15N2,d8, 99%. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 5mg, 100MG, 1 mg, 5 mg, 10 mg.
Deuterio (2S)-2,3,3-trideuterio-2,4-bis(dideuterio(15N)amino)-4-oxo(1,2,3,4-13C4)butanoate (CAS 1217464-18-0) is a chemical compound with the molecular formula C4H8N2O3 and a molecular weight of 146.125 g/mol. IUPAC name: deuterio (2S)-2,3,3-trideuterio-2,4-bis(dideuterio(15N)amino)-4-oxo(1,2,3,4-13C4)butanoate. InChIKey: DCXYFEDJOCDNAF-PYHFAUOHSA-N.
| Molecular formula | C4H8N2O3 |
|---|---|
| Molecular weight | 146.125 g/mol |
| IUPAC name | deuterio (2S)-2,3,3-trideuterio-2,4-bis(dideuterio(15N)amino)-4-oxo(1,2,3,4-13C4)butanoate |
| InChIKey | DCXYFEDJOCDNAF-PYHFAUOHSA-N |
| SMILES | [2H][13C@@]([13C](=O)O[2H])([13C]([2H])([2H])[13C](=O)[15N]([2H])[2H])[15N]([2H])[2H] |
Computed by PubChem (NCBI)