Products 1217473-37-4
CAS 1217473-37-4 appears in our catalog under these names: L-ASPARAGINE-15N2,D8, 98 ATOM% 15N, 98 &, L-Asparagine-15N2,d8. Offered by: Sigma-Aldrich, MedChemExpress. Available pack sizes: 100MG, 100 mg, 50 mg, 10 mg, 25 mg, 5 mg.
Deuterio (2S)-2,3,3-trideuterio-2,4-bis(dideuterio(15N)amino)-4-oxobutanoate (CAS 1217473-37-4) is a chemical compound with the molecular formula C4H8N2O3 and a molecular weight of 142.15 g/mol. IUPAC name: deuterio (2S)-2,3,3-trideuterio-2,4-bis(dideuterio(15N)amino)-4-oxobutanoate. InChIKey: DCXYFEDJOCDNAF-VYGMAKJPSA-N.
| Molecular formula | C4H8N2O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | deuterio (2S)-2,3,3-trideuterio-2,4-bis(dideuterio(15N)amino)-4-oxobutanoate |
| InChIKey | DCXYFEDJOCDNAF-VYGMAKJPSA-N |
| SMILES | [2H][C@@](C(=O)O[2H])(C([2H])([2H])C(=O)[15N]([2H])[2H])[15N]([2H])[2H] |
Computed by PubChem (NCBI)