Products 768348-44-3
CAS 768348-44-3 is the registry number for L-Asparagine-1,2,3,4-13C4 (monohydrate). Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
(2S)-2,4-diamino-4-oxo(1,2,3,4-13C4)butanoic acid (CAS 768348-44-3) is a chemical compound with the molecular formula C4H8N2O3 and a molecular weight of 136.09 g/mol. IUPAC name: (2S)-2,4-diamino-4-oxo(1,2,3,4-13C4)butanoic acid. InChIKey: DCXYFEDJOCDNAF-UVYXLFMMSA-N.
| Molecular formula | C4H8N2O3 |
|---|---|
| Molecular weight | 136.09 g/mol |
| IUPAC name | (2S)-2,4-diamino-4-oxo(1,2,3,4-13C4)butanoic acid |
| InChIKey | DCXYFEDJOCDNAF-UVYXLFMMSA-N |
| SMILES | [13CH2]([13C@@H]([13C](=O)O)N)[13C](=O)N |
Computed by PubChem (NCBI)