CAS 1217465-66-1 appears in our catalog under these names: (R)-1-(2-Fluoro-5-methylphenyl)ethanamine hydrochloride, 95+%, (R)-1-(2-Fluoro-5-methylphenyl)ethanamine hydrochloride, 95+%, 95+%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.
(1R)-1-(2-fluoro-5-methylphenyl)ethanamine;hydrochloride (CAS 1217465-66-1) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(2-fluoro-5-methylphenyl)ethanamine;hydrochloride. InChIKey: HJMGPKQOWKNPAE-OGFXRTJISA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(2-fluoro-5-methylphenyl)ethanamine;hydrochloride |
| InChIKey | HJMGPKQOWKNPAE-OGFXRTJISA-N |
| SMILES | CC1=CC(=C(C=C1)F)[C@@H](C)N.Cl |
Computed by PubChem (NCBI)