Products 1217475-13-2
CAS 1217475-13-2 is the registry number for L-Aspartic acid-13C4,15N,d3, 99.9%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg.
(2S)-2-(15N)azanyl-2,3,3-trideuterio(1,2,3,4-13C4)butanedioic acid (CAS 1217475-13-2) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 141.085 g/mol. IUPAC name: (2S)-2-(15N)azanyl-2,3,3-trideuterio(1,2,3,4-13C4)butanedioic acid. InChIKey: CKLJMWTZIZZHCS-ULNHBARWSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 141.085 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-2,3,3-trideuterio(1,2,3,4-13C4)butanedioic acid |
| InChIKey | CKLJMWTZIZZHCS-ULNHBARWSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])[13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)